C25H23N3OS — CID 17368289
4-(4-methylphenyl)-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine (PubChem CID 17368289) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-methylphenyl)-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17368289 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-(4-methylphenyl)-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine |
| SMILES | C/C(=N/Nc1nc(-c2ccc(C)cc2)cs1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3OS/c1-18-8-10-22(11-9-18)24-17-30-25(26-24)28-27-19(2)21-12-14-23(15-13-21)29-16-20-6-4-3-5-7-20/h3-15,17H,16H2,1-2H3,(H,26,28)/b27-19- |
| InChIKey | JGFDWBNSLXIQDX-DIBXZPPDSA-N |
| XLogP | 6.53 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|