C18H17Br2N3OS — CID 90484602
4-(4-bromophenyl)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide (PubChem CID 90484602) has the molecular formula C18H17Br2N3OS and a molecular weight of 483.23 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | 4-(4-bromophenyl)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 90484602 |
| Molecular Formula | C18H17Br2N3OS |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.COc1ccc(/C(C)=N\Nc2nc(-c3ccc(Br)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H16BrN3OS.BrH/c1-12(13-5-9-16(23-2)10-6-13)21-22-18-20-17(11-24-18)14-3-7-15(19)8-4-14;/h3-11H,1-2H3,(H,20,22);1H/b21-12-; |
| InChIKey | JPDOZLZLMIXLRG-SDKPGJOKSA-N |
| XLogP | 6.00 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|