C19H18BrN3S — CID 3136093
N-[1-(4-bromophenyl)ethylideneamino]-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 3136093) has the molecular formula C19H18BrN3S and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethylideneamino]-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[1-(4-bromophenyl)ethylideneamino]-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3136093 |
| Molecular Formula | C19H18BrN3S |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-[1-(4-bromophenyl)ethylideneamino]-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | CC(=NNc1nc(-c2cc(C)ccc2C)cs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrN3S/c1-12-4-5-13(2)17(10-12)18-11-24-19(21-18)23-22-14(3)15-6-8-16(20)9-7-15/h4-11H,1-3H3,(H,21,23) |
| InChIKey | DCVYNICZOSDGSB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|