C20H13Br2N3O2S — CID 6014883
6,8-dibromo-3-[2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 6014883) has the molecular formula C20H13Br2N3O2S and a molecular weight of 519.22 g/mol. Its IUPAC name is 6,8-dibromo-3-[2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 6014883 |
| Molecular Formula | C20H13Br2N3O2S |
| Molecular Weight | 519.22 g/mol |
| Exact Mass | 516.91 |
| IUPAC Name | 6,8-dibromo-3-[2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | C/C(=N/Nc1nc(-c2cc3cc(Br)cc(Br)c3oc2=O)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H13Br2N3O2S/c1-11(12-5-3-2-4-6-12)24-25-20-23-17(10-28-20)15-8-13-7-14(21)9-16(22)18(13)27-19(15)26/h2-10H,1H3,(H,23,25)/b24-11- |
| InChIKey | FYXBMBPYXJVDTR-MYKKPKGFSA-N |
| XLogP | 6.28 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.22 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|