C27H29N5OS — CID 4086590
N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 4086590) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4086590 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(NN=C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H29N5OS/c1-31(2)22-12-6-20(7-13-22)26(21-8-14-23(15-9-21)32(3)4)29-30-27-28-25(18-34-27)19-10-16-24(33-5)17-11-19/h6-18H,1-5H3,(H,28,30) |
| InChIKey | JUWBORLKTDTANB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|