C19H19N3OS — CID 682583
4-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-N,N-dimethylaniline (PubChem CID 682583) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 682583 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2csc(N=Cc3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-22(2)16-8-4-14(5-9-16)12-20-19-21-18(13-24-19)15-6-10-17(23-3)11-7-15/h4-13H,1-3H3 |
| InChIKey | ABXMSZNFMLLCCT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|