C23H15ClN2O2S — CID 46502111
[4-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenyl] 2-chlorobenzoate (PubChem CID 46502111) has the molecular formula C23H15ClN2O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is [4-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 46502111 |
| Molecular Formula | C23H15ClN2O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2nc(-c3ccccc3)cs2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H15ClN2O2S/c24-20-9-5-4-8-19(20)22(27)28-18-12-10-16(11-13-18)14-25-23-26-21(15-29-23)17-6-2-1-3-7-17/h1-15H/b25-14+ |
| InChIKey | DGAWLGFXRKYQJO-AFUMVMLFSA-N |
| XLogP | 6.43 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|