C23H17N5O4S — CID 3315921
N-[[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 3315921) has the molecular formula C23H17N5O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3315921 |
| Molecular Formula | C23H17N5O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-[[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(C(=NNc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H17N5O4S/c1-15-2-4-17(5-3-15)22(18-8-12-20(13-9-18)28(31)32)25-26-23-24-21(14-33-23)16-6-10-19(11-7-16)27(29)30/h2-14H,1H3,(H,24,26) |
| InChIKey | UFIFOCGOTUACDJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|