C21H16N4O2S — CID 7209658
N-[(E)-1-naphthalen-1-ylethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 7209658) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[(E)-1-naphthalen-1-ylethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-1-naphthalen-1-ylethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 7209658 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(E)-1-naphthalen-1-ylethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | C/C(=N\Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H16N4O2S/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)23-24-21-22-20(13-28-21)16-9-11-17(12-10-16)25(26)27/h2-13H,1H3,(H,22,24)/b23-14+ |
| InChIKey | NIGCHHLCWVUNPV-OEAKJJBVSA-N |
| XLogP | 5.71 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|