C18H14N4S — CID 71540248
4-[2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 71540248) has the molecular formula C18H14N4S and a molecular weight of 318.41 g/mol. Its IUPAC name is 4-[2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 71540248 |
| Molecular Formula | C18H14N4S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | C/C(=N\Nc1nc(-c2ccc(C#N)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C18H14N4S/c1-13(15-5-3-2-4-6-15)21-22-18-20-17(12-23-18)16-9-7-14(11-19)8-10-16/h2-10,12H,1H3,(H,20,22)/b21-13+ |
| InChIKey | FTIQJYPMEOMUDM-FYJGNVAPSA-N |
| XLogP | 4.52 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|