C21H18N4S — CID 78614568
N-[1-(4-aminophenyl)ethylideneamino]-4-naphthalen-2-yl-1,3-thiazol-2-amine (PubChem CID 78614568) has the molecular formula C21H18N4S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethylideneamino]-4-naphthalen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[1-(4-aminophenyl)ethylideneamino]-4-naphthalen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 78614568 |
| Molecular Formula | C21H18N4S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[1-(4-aminophenyl)ethylideneamino]-4-naphthalen-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(=NNc1nc(-c2ccc3ccccc3c2)cs1)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H18N4S/c1-14(15-8-10-19(22)11-9-15)24-25-21-23-20(13-26-21)18-7-6-16-4-2-3-5-17(16)12-18/h2-13H,22H2,1H3,(H,23,25) |
| InChIKey | YOENRRNRHWQDLH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|