C21H25N3S — CID 90665470
4-naphthalen-2-yl-N-[(Z)-octan-2-ylideneamino]-1,3-thiazol-2-amine (PubChem CID 90665470) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is 4-naphthalen-2-yl-N-[(Z)-octan-2-ylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-naphthalen-2-yl-N-[(Z)-octan-2-ylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 90665470 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-naphthalen-2-yl-N-[(Z)-octan-2-ylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCCCCC/C(C)=N\Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C21H25N3S/c1-3-4-5-6-9-16(2)23-24-21-22-20(15-25-21)19-13-12-17-10-7-8-11-18(17)14-19/h7-8,10-15H,3-6,9H2,1-2H3,(H,22,24)/b23-16- |
| InChIKey | BJDVFBRSKDBQHH-KQWNVCNZSA-N |
| XLogP | 6.72 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|