C16H19Cl2N3S — CID 71739546
4-(2,4-dichlorophenyl)-N-[(E)-heptan-2-ylideneamino]-1,3-thiazol-2-amine (PubChem CID 71739546) has the molecular formula C16H19Cl2N3S and a molecular weight of 356.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(E)-heptan-2-ylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(E)-heptan-2-ylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 71739546 |
| Molecular Formula | C16H19Cl2N3S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(E)-heptan-2-ylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCCCC/C(C)=N/Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C16H19Cl2N3S/c1-3-4-5-6-11(2)20-21-16-19-15(10-22-16)13-8-7-12(17)9-14(13)18/h7-10H,3-6H2,1-2H3,(H,19,21)/b20-11+ |
| InChIKey | OUKHOPGGTZWKHP-RGVLZGJSSA-N |
| XLogP | 6.49 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|