C15H11Cl2N3OS — CID 6862717
4-(2,4-dichlorophenyl)-N-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 6862717) has the molecular formula C15H11Cl2N3OS and a molecular weight of 352.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6862717 |
| Molecular Formula | C15H11Cl2N3OS |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(/C=N/Nc2nc(-c3ccc(Cl)cc3Cl)cs2)o1 |
| InChI | InChI=1S/C15H11Cl2N3OS/c1-9-2-4-11(21-9)7-18-20-15-19-14(8-22-15)12-5-3-10(16)6-13(12)17/h2-8H,1H3,(H,19,20)/b18-7+ |
| InChIKey | PHNFIZKVAQVOHY-CNHKJKLMSA-N |
| XLogP | 5.46 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_furan_A(6)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|