C17H13Cl2N3O2S — CID 110339448
5-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 110339448) has the molecular formula C17H13Cl2N3O2S and a molecular weight of 394.28 g/mol. Its IUPAC name is 5-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 5-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 110339448 |
| Molecular Formula | C17H13Cl2N3O2S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 5-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(/C=N/Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1O |
| InChI | InChI=1S/C17H13Cl2N3O2S/c1-24-16-5-2-10(6-15(16)23)8-20-22-17-21-14(9-25-17)12-4-3-11(18)7-13(12)19/h2-9,23H,1H3,(H,21,22)/b20-8+ |
| InChIKey | LGRIDWCSTBMFDW-DNTJNYDQSA-N |
| XLogP | 5.28 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|