C16H10Cl2N4O3S — CID 135777358
4-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-nitrophenol (PubChem CID 135777358) has the molecular formula C16H10Cl2N4O3S and a molecular weight of 409.25 g/mol. Its IUPAC name is 4-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-nitrophenol.
| Compound Name | 4-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-nitrophenol |
|---|---|
| PubChem CID | 135777358 |
| Molecular Formula | C16H10Cl2N4O3S |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 4-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/Nc2nc(-c3ccc(Cl)cc3Cl)cs2)ccc1O |
| InChI | InChI=1S/C16H10Cl2N4O3S/c17-10-2-3-11(12(18)6-10)13-8-26-16(20-13)21-19-7-9-1-4-15(23)14(5-9)22(24)25/h1-8,23H,(H,20,21)/b19-7+ |
| InChIKey | CZJZKZYKRBNHAF-FBCYGCLPSA-N |
| XLogP | 5.18 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|