C23H15Cl4N3OS — CID 124541077
4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 124541077) has the molecular formula C23H15Cl4N3OS and a molecular weight of 523.27 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124541077 |
| Molecular Formula | C23H15Cl4N3OS |
| Molecular Weight | 523.27 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(N/N=C\c3ccc(OCc4c(Cl)cccc4Cl)cc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C23H15Cl4N3OS/c24-15-6-9-17(21(27)10-15)22-13-32-23(29-22)30-28-11-14-4-7-16(8-5-14)31-12-18-19(25)2-1-3-20(18)26/h1-11,13H,12H2,(H,29,30)/b28-11- |
| InChIKey | GDIORQGYGLKSPX-FXMZOFOKSA-N |
| XLogP | 8.45 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.27 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|