C19H13Cl2N3OS — CID 155923376
4-(2,4-dichlorophenyl)-N-[(E)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 155923376) has the molecular formula C19H13Cl2N3OS and a molecular weight of 402.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(E)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(E)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155923376 |
| Molecular Formula | C19H13Cl2N3OS |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(E)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | C#CCOc1ccccc1/C=N/Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C19H13Cl2N3OS/c1-2-9-25-18-6-4-3-5-13(18)11-22-24-19-23-17(12-26-19)15-8-7-14(20)10-16(15)21/h1,3-8,10-12H,9H2,(H,23,24)/b22-11+ |
| InChIKey | CKQABIMQPJJVKF-SSDVNMTOSA-N |
| XLogP | 5.57 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|