C15H10Cl2N4S — CID 3793731
4-(2,4-dichlorophenyl)-N-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-amine (PubChem CID 3793731) has the molecular formula C15H10Cl2N4S and a molecular weight of 349.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3793731 |
| Molecular Formula | C15H10Cl2N4S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(NN=Cc3ccccn3)n2)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N4S/c16-10-4-5-12(13(17)7-10)14-9-22-15(20-14)21-19-8-11-3-1-2-6-18-11/h1-9H,(H,20,21) |
| InChIKey | QIEBXAOFFZLTDB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|