C20H13Cl2N3OS — CID 135648455
1-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 135648455) has the molecular formula C20H13Cl2N3OS and a molecular weight of 414.32 g/mol. Its IUPAC name is 1-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135648455 |
| Molecular Formula | C20H13Cl2N3OS |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-[(E)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N/Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C20H13Cl2N3OS/c21-13-6-7-15(17(22)9-13)18-11-27-20(24-18)25-23-10-16-14-4-2-1-3-12(14)5-8-19(16)26/h1-11,26H,(H,24,25)/b23-10+ |
| InChIKey | MEVQYEXLTMCTDE-AUEPDCJTSA-N |
| XLogP | 6.42 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|