C28H20Cl2FN3S — CID 126190746
4-(2,4-dichlorophenyl)-N-[(Z)-[2-[2-(2-fluorophenyl)ethyl]naphthalen-1-yl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 126190746) has the molecular formula C28H20Cl2FN3S and a molecular weight of 520.46 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(Z)-[2-[2-(2-fluorophenyl)ethyl]naphthalen-1-yl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[2-[2-(2-fluorophenyl)ethyl]naphthalen-1-yl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 126190746 |
| Molecular Formula | C28H20Cl2FN3S |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[2-[2-(2-fluorophenyl)ethyl]naphthalen-1-yl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Fc1ccccc1CCc1ccc2ccccc2c1/C=N\Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C28H20Cl2FN3S/c29-21-13-14-23(25(30)15-21)27-17-35-28(33-27)34-32-16-24-19(10-9-18-5-1-3-7-22(18)24)11-12-20-6-2-4-8-26(20)31/h1-10,13-17H,11-12H2,(H,33,34)/b32-16- |
| InChIKey | YNJVRVFOSWINHL-ZMGVVAQMSA-N |
| XLogP | 8.64 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|