C22H15Cl2N3O3S2 — CID 6030234
[4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 6030234) has the molecular formula C22H15Cl2N3O3S2 and a molecular weight of 504.42 g/mol. Its IUPAC name is [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 6030234 |
| Molecular Formula | C22H15Cl2N3O3S2 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(/C=N\Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2N3O3S2/c23-16-8-11-19(20(24)12-16)21-14-31-22(26-21)27-25-13-15-6-9-17(10-7-15)30-32(28,29)18-4-2-1-3-5-18/h1-14H,(H,26,27)/b25-13- |
| InChIKey | KPYXCUOLOILYTE-MXAYSNPKSA-N |
| XLogP | 6.33 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|