C27H23Cl2N3O2S — CID 124541070
[4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-tert-butylbenzoate (PubChem CID 124541070) has the molecular formula C27H23Cl2N3O2S and a molecular weight of 524.47 g/mol. Its IUPAC name is [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 124541070 |
| Molecular Formula | C27H23Cl2N3O2S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2ccc(/C=N\Nc3nc(-c4ccc(Cl)cc4Cl)cs3)cc2)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O2S/c1-27(2,3)19-8-6-18(7-9-19)25(33)34-21-11-4-17(5-12-21)15-30-32-26-31-24(16-35-26)22-13-10-20(28)14-23(22)29/h4-16H,1-3H3,(H,31,32)/b30-15- |
| InChIKey | GYSBUZNFSGDVLI-MNDYBZJGSA-N |
| XLogP | 8.08 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|