C18H14FN3O2S — CID 27269074
[4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate (PubChem CID 27269074) has the molecular formula C18H14FN3O2S and a molecular weight of 355.39 g/mol. Its IUPAC name is [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 27269074 |
| Molecular Formula | C18H14FN3O2S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
| SMILES | Cc1csc(N/N=C\c2ccc(OC(=O)c3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C18H14FN3O2S/c1-12-11-25-18(21-12)22-20-10-13-2-8-16(9-3-13)24-17(23)14-4-6-15(19)7-5-14/h2-11H,1H3,(H,21,22)/b20-10- |
| InChIKey | AMOSTXCFIHKUFM-JMIUGGIZSA-N |
| XLogP | 4.26 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|