C20H16FN3O3S — CID 110341092
[4-[(E)-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate (PubChem CID 110341092) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is [4-[(E)-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(E)-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110341092 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [4-[(E)-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
| SMILES | Cc1nc(C)c(C(=O)N/N=C/c2ccc(OC(=O)c3ccc(F)cc3)cc2)s1 |
| InChI | InChI=1S/C20H16FN3O3S/c1-12-18(28-13(2)23-12)19(25)24-22-11-14-3-9-17(10-4-14)27-20(26)15-5-7-16(21)8-6-15/h3-11H,1-2H3,(H,24,25)/b22-11+ |
| InChIKey | YNYNQHUQJHPDNC-SSDVNMTOSA-N |
| XLogP | 3.88 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|