C17H16FN3O2S — CID 110341082
[4-[(E)-(ethylcarbamothioylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate (PubChem CID 110341082) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is [4-[(E)-(ethylcarbamothioylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(E)-(ethylcarbamothioylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110341082 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [4-[(E)-(ethylcarbamothioylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate |
| SMILES | CCNC(=S)N/N=C/c1ccc(OC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-2-19-17(24)21-20-11-12-3-9-15(10-4-12)23-16(22)13-5-7-14(18)8-6-13/h3-11H,2H2,1H3,(H2,19,21,24)/b20-11+ |
| InChIKey | TZOWZOIWMHTHSW-RGVLZGJSSA-N |
| XLogP | 2.86 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|