C13H17N3O3S — CID 3606509
methyl 2-[4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 3606509) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 2-[4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3606509 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | methyl 2-[4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCNC(=S)NN=Cc1ccc(OCC(=O)OC)cc1 |
| InChI | InChI=1S/C13H17N3O3S/c1-3-14-13(20)16-15-8-10-4-6-11(7-5-10)19-9-12(17)18-2/h4-8H,3,9H2,1-2H3,(H2,14,16,20) |
| InChIKey | OFZCZZYCXJGADA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|