C13H12BrN3OS — CID 2337797
N-[(4-bromophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 2337797) has the molecular formula C13H12BrN3OS and a molecular weight of 338.23 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 2337797 |
| Molecular Formula | C13H12BrN3OS |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NN=Cc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C13H12BrN3OS/c1-8-12(19-9(2)16-8)13(18)17-15-7-10-3-5-11(14)6-4-10/h3-7H,1-2H3,(H,17,18) |
| InChIKey | JKAYEOCUSVWZES-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|