C13H11F3N4OS — CID 5398429
2-amino-4-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 5398429) has the molecular formula C13H11F3N4OS and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 5398429 |
| Molecular Formula | C13H11F3N4OS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-amino-4-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3N4OS/c1-7-10(22-12(17)19-7)11(21)20-18-6-8-2-4-9(5-3-8)13(14,15)16/h2-6H,1H3,(H2,17,19)(H,20,21)/b18-6- |
| InChIKey | ANTLKFRXEQSREB-FXBPXSCXSA-N |
| XLogP | 2.82 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|