C14H13F3N4OS — CID 110511394
2-amino-4-ethyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 110511394) has the molecular formula C14H13F3N4OS and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-amino-4-ethyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-ethyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110511394 |
| Molecular Formula | C14H13F3N4OS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-amino-4-ethyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(N)sc1C(=O)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N4OS/c1-2-10-11(23-13(18)20-10)12(22)21-19-7-8-3-5-9(6-4-8)14(15,16)17/h3-7H,2H2,1H3,(H2,18,20)(H,21,22)/b19-7- |
| InChIKey | HXBNOZSCWKUGCO-GXHLCREISA-N |
| XLogP | 3.07 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|