C13H13BrN4O2S — CID 136787337
2-amino-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 136787337) has the molecular formula C13H13BrN4O2S and a molecular weight of 369.24 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-ethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-ethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 136787337 |
| Molecular Formula | C13H13BrN4O2S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-amino-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(N)sc1C(=O)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H13BrN4O2S/c1-2-9-11(21-13(15)17-9)12(20)18-16-6-7-5-8(14)3-4-10(7)19/h3-6,19H,2H2,1H3,(H2,15,17)(H,18,20)/b16-6- |
| InChIKey | WGYJTTCRSZADGQ-SOFYXZRVSA-N |
| XLogP | 2.52 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|