C12H10N5O4S- — CID 7894601
4-[[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 7894601) has the molecular formula C12H10N5O4S- and a molecular weight of 320.31 g/mol. Its IUPAC name is 4-[[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7894601 |
| Molecular Formula | C12H10N5O4S- |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-[[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | Cc1nc(N)sc1C(=O)NN=Cc1ccc([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11N5O4S/c1-6-10(22-12(13)15-6)11(19)16-14-5-7-2-3-9(18)8(4-7)17(20)21/h2-5,18H,1H3,(H2,13,15)(H,16,19)/p-1 |
| InChIKey | IXQCFBLDIDTPEP-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|