C14H13N5O3S — CID 75362340
2-amino-4-methyl-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-thiazole-5-carboxamide (PubChem CID 75362340) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75362340 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-amino-4-methyl-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)N/N=C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N5O3S/c1-9-12(23-14(15)17-9)13(20)18-16-8-4-6-10-5-2-3-7-11(10)19(21)22/h2-8H,1H3,(H2,15,17)(H,18,20)/b6-4+,16-8+ |
| InChIKey | BVQSHSZRFMGUBI-LWOAUJEXSA-N |
| XLogP | 2.37 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|