C20H19N5O5S — CID 110510231
2-amino-N-[(Z)-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 110510231) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[(Z)-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110510231 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-amino-N-[(Z)-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2sc(N)nc2C)cc([N+](=O)[O-])c1OCc1ccccc1 |
| InChI | InChI=1S/C20H19N5O5S/c1-12-18(31-20(21)23-12)19(26)24-22-10-14-8-15(25(27)28)17(16(9-14)29-2)30-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H2,21,23)(H,24,26)/b22-10- |
| InChIKey | YNJJPFYZXSSIHM-YVNNLAQVSA-N |
| XLogP | 3.29 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|