C16H13N4O5- — CID 8897399
4-[(Z)-[[2-(4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 8897399) has the molecular formula C16H13N4O5- and a molecular weight of 341.30 g/mol. Its IUPAC name is 4-[(Z)-[[2-(4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[[2-(4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 8897399 |
| Molecular Formula | C16H13N4O5- |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-[(Z)-[[2-(4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C\c2ccc([O-])c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H14N4O5/c1-10-2-5-12(6-3-10)18-15(22)16(23)19-17-9-11-4-7-14(21)13(8-11)20(24)25/h2-9,21H,1H3,(H,18,22)(H,19,23)/p-1/b17-9- |
| InChIKey | SYOJERWQCFDTDA-MFOYZWKCSA-M |
| XLogP | 1.07 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|