C23H19N5O8 — CID 4520832
N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 4520832) has the molecular formula C23H19N5O8 and a molecular weight of 493.43 g/mol. Its IUPAC name is N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 4520832 |
| Molecular Formula | C23H19N5O8 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccc(C)cc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19N5O8/c1-14-3-6-16(7-4-14)25-22(29)23(30)26-24-13-15-5-9-20(21(11-15)35-2)36-19-10-8-17(27(31)32)12-18(19)28(33)34/h3-13H,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | VZCCKGPHNOAUIZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|