C24H18N6O8 — CID 4598186
N-[4-(cyanomethyl)phenyl]-N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]oxamide (PubChem CID 4598186) has the molecular formula C24H18N6O8 and a molecular weight of 518.44 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 4598186 |
| Molecular Formula | C24H18N6O8 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-N'-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccc(CC#N)cc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N6O8/c1-37-22-12-16(4-8-21(22)38-20-9-7-18(29(33)34)13-19(20)30(35)36)14-26-28-24(32)23(31)27-17-5-2-15(3-6-17)10-11-25/h2-9,12-14H,10H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | GTIJASPMKYMGCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 199.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|