C25H23N5O10 — CID 3439234
N-(2,4-dimethoxyphenyl)-N'-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]oxamide (PubChem CID 3439234) has the molecular formula C25H23N5O10 and a molecular weight of 553.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3439234 |
| Molecular Formula | C25H23N5O10 |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccc(OC)cc2OC)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23N5O10/c1-4-39-23-11-15(5-9-21(23)40-20-10-6-16(29(33)34)12-19(20)30(35)36)14-26-28-25(32)24(31)27-18-8-7-17(37-2)13-22(18)38-3/h5-14H,4H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | KOJDHNCCRJJAJL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 193.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|