C24H23N5O7 — CID 5131261
N-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-(2-methylanilino)acetamide (PubChem CID 5131261) has the molecular formula C24H23N5O7 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-(2-methylanilino)acetamide.
| Compound Name | N-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-(2-methylanilino)acetamide |
|---|---|
| PubChem CID | 5131261 |
| Molecular Formula | C24H23N5O7 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-(2-methylanilino)acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CNc2ccccc2C)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N5O7/c1-3-35-23-12-17(14-26-27-24(30)15-25-19-7-5-4-6-16(19)2)8-10-22(23)36-21-11-9-18(28(31)32)13-20(21)29(33)34/h4-14,25H,3,15H2,1-2H3,(H,27,30) |
| InChIKey | KYSDMAVCWZBKKU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|