C26H26N4O6S — CID 126020544
2-[2-ethoxy-4-[(Z)-[[2-(4-nitrophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126020544) has the molecular formula C26H26N4O6S and a molecular weight of 522.58 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[[2-(4-nitrophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[[2-(4-nitrophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126020544 |
| Molecular Formula | C26H26N4O6S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[[2-(4-nitrophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CSc2ccc([N+](=O)[O-])cc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H26N4O6S/c1-3-35-24-14-19(8-13-23(24)36-16-25(31)28-22-7-5-4-6-18(22)2)15-27-29-26(32)17-37-21-11-9-20(10-12-21)30(33)34/h4-15H,3,16-17H2,1-2H3,(H,28,31)(H,29,32)/b27-15- |
| InChIKey | OCFCLLPKACTBON-DICXZTSXSA-N |
| XLogP | 4.56 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|