C29H28N4O4 — CID 126021151
N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 126021151) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 126021151 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2-n2cccc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C29H28N4O4/c1-3-36-27-18-22(14-15-26(27)37-20-28(34)31-24-12-6-4-10-21(24)2)19-30-32-29(35)23-11-5-7-13-25(23)33-16-8-9-17-33/h4-19H,3,20H2,1-2H3,(H,31,34)(H,32,35)/b30-19- |
| InChIKey | QECCPLZHQRLIEC-FSGOGVSDSA-N |
| XLogP | 4.97 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|