C27H21N5O8S — CID 4278661
N-[2-[[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 4278661) has the molecular formula C27H21N5O8S and a molecular weight of 575.56 g/mol. Its IUPAC name is N-[2-[[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4278661 |
| Molecular Formula | C27H21N5O8S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | N-[2-[[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccccc2NC(=O)c2cccs2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21N5O8S/c1-2-39-24-14-17(9-11-23(24)40-22-12-10-18(31(35)36)15-21(22)32(37)38)16-28-30-26(33)19-6-3-4-7-20(19)29-27(34)25-8-5-13-41-25/h3-16H,2H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | WVXGQQPFMIUHHT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|