C17H17N5O6S — CID 126375833
1-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126375833) has the molecular formula C17H17N5O6S and a molecular weight of 419.42 g/mol. Its IUPAC name is 1-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126375833 |
| Molecular Formula | C17H17N5O6S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 1-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C17H17N5O6S/c1-3-18-17(29)20-19-10-11-4-6-15(16(8-11)27-2)28-14-7-5-12(21(23)24)9-13(14)22(25)26/h4-10H,3H2,1-2H3,(H2,18,20,29)/b19-10- |
| InChIKey | DULFELVBNJOTOR-GRSHGNNSSA-N |
| XLogP | 3.12 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|