C18H14N4O4S — CID 126077216
[4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126077216) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126077216 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [4-[(Z)-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | Cc1csc(N/N=C\c2ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc2)n1 |
| InChI | InChI=1S/C18H14N4O4S/c1-12-11-27-18(20-12)21-19-10-13-2-8-16(9-3-13)26-17(23)14-4-6-15(7-5-14)22(24)25/h2-11H,1H3,(H,20,21)/b19-10- |
| InChIKey | NJWDKUCLHDNPMF-GRSHGNNSSA-N |
| XLogP | 4.02 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|