C21H16N4O6 — CID 94844462
[4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 94844462) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 94844462 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H16N4O6/c1-14-2-6-16(7-3-14)21(26)31-18-9-4-15(5-10-18)13-22-23-19-11-8-17(24(27)28)12-20(19)25(29)30/h2-13,23H,1H3/b22-13- |
| InChIKey | HYLCDCWRIWABHF-XKZIYDEJSA-N |
| XLogP | 4.48 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|