C20H15N5O8S — CID 3876384
[4-[[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 3876384) has the molecular formula C20H15N5O8S and a molecular weight of 485.43 g/mol. Its IUPAC name is [4-[[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [4-[[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 3876384 |
| Molecular Formula | C20H15N5O8S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | [4-[[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | NS(=O)(=O)c1ccc(NN=Cc2ccc(OC(=O)c3cccc([N+](=O)[O-])c3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15N5O8S/c21-34(31,32)17-8-9-18(19(11-17)25(29)30)23-22-12-13-4-6-16(7-5-13)33-20(26)14-2-1-3-15(10-14)24(27)28/h1-12,23H,(H2,21,31,32) |
| InChIKey | AKQHXGJWYSYLFR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 197.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|