C21H15N5O9 — CID 6229262
[4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-nitrophenyl] 4-methoxybenzoate (PubChem CID 6229262) has the molecular formula C21H15N5O9 and a molecular weight of 481.38 g/mol. Its IUPAC name is [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-nitrophenyl] 4-methoxybenzoate.
| Compound Name | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-nitrophenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6229262 |
| Molecular Formula | C21H15N5O9 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-nitrophenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15N5O9/c1-34-16-6-3-14(4-7-16)21(27)35-20-9-2-13(10-19(20)26(32)33)12-22-23-17-8-5-15(24(28)29)11-18(17)25(30)31/h2-12,23H,1H3/b22-12- |
| InChIKey | YVMWFFMHCJRRHM-UUYOSTAYSA-N |
| XLogP | 4.09 |
| TPSA | 189.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|