C18H18N4O8 — CID 126214584
ethyl 2-[5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126214584) has the molecular formula C18H18N4O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is ethyl 2-[5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126214584 |
| Molecular Formula | C18H18N4O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | ethyl 2-[5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C18H18N4O8/c1-3-29-18(23)11-30-17-8-12(4-7-16(17)28-2)10-19-20-14-6-5-13(21(24)25)9-15(14)22(26)27/h4-10,20H,3,11H2,1-2H3/b19-10+ |
| InChIKey | BEOYWQAPYBTISV-VXLYETTFSA-N |
| XLogP | 2.90 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|