C15H14N4O6 — CID 136671550
4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-ethoxyphenol (PubChem CID 136671550) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is 4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-ethoxyphenol.
| Compound Name | 4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 136671550 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H14N4O6/c1-2-25-15-7-10(3-6-14(15)20)9-16-17-12-5-4-11(18(21)22)8-13(12)19(23)24/h3-9,17,20H,2H2,1H3/b16-9- |
| InChIKey | PSQDZKRTYMXWEW-SXGWCWSVSA-N |
| XLogP | 3.05 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|