C15H12N4O7 — CID 21370898
2-[4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 21370898) has the molecular formula C15H12N4O7 and a molecular weight of 360.28 g/mol. Its IUPAC name is 2-[4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21370898 |
| Molecular Formula | C15H12N4O7 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N4O7/c20-15(21)9-26-12-4-1-10(2-5-12)8-16-17-13-6-3-11(18(22)23)7-14(13)19(24)25/h1-8,17H,9H2,(H,20,21)/b16-8+ |
| InChIKey | XRXLWMPODPRXNC-LZYBPNLTSA-N |
| XLogP | 2.41 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|